AE54504
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE54504 |
Chemical Name: | 4-nitrobenzenediazonium chloride |
CAS Number: | 100-05-0 |
Molecular Formula: | C6H4ClN3O2 |
Molecular Weight: | 185.5679 |
MDL Number: | MFCD00061502 |
SMILES: | N#[N+]c1ccc(cc1)[N+](=O)[O-].[Cl-] |
4-Nitrobenzenediazonium chloride is a versatile compound widely used in chemical synthesis, particularly in the field of organic chemistry. This powerful diazonium salt serves as a key building block for the preparation of a range of valuable intermediates and functional molecules. Its primary application lies in the formation of aryl compounds through the process of diazo coupling reactions.By reacting 4-Nitrobenzenediazonium chloride with various nucleophiles or active hydrogen-containing compounds, chemists can generate an array of substituted aromatic compounds. These products can exhibit diverse chemical and physical properties, making them valuable for pharmaceutical, agrochemical, and materials science applications. Additionally, the nitro group present in the diazonium salt can be further manipulated to introduce functional groups or facilitate additional transformations in the synthesized molecules.In the realm of chemical synthesis, 4-Nitrobenzenediazonium chloride plays a crucial role in the creation of complex organic molecules with tailored structures and properties. Its versatility and reactivity make it a valuable tool for researchers and synthetic chemists working towards developing novel compounds for various industrial and scientific purposes.