AA00039
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98%(GC) | in stock | $28.00 | $20.00 | - + | |
5g | 98%(GC) | in stock | $57.00 | $40.00 | - + | |
25g | 98%(GC) | in stock | $202.00 | $141.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA00039 |
Chemical Name: | 4-Nitrophenyl isocyanate |
CAS Number: | 100-28-7 |
Molecular Formula: | C7H4N2O3 |
Molecular Weight: | 164.1183 |
MDL Number: | MFCD00007306 |
SMILES: | O=C=Nc1ccc(cc1)[N+](=O)[O-] |
NSC Number: | 9800 |
Complexity: | 209 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
XLogP3: | 3 |
The open medicinal chemistry journal 20070101