logo
Home  > N-(4-(n-(4,6-dimethylpyrimidin-2-yl)sulfamoyl)phenyl)acetamide

AA00079

100-90-3 | N-(4-(n-(4,6-dimethylpyrimidin-2-yl)sulfamoyl)phenyl)acetamide

Packsize Purity Availability Price Discounted Price    Quantity
5mg 98% in stock $658.00 $461.00 -   +
10mg 98% in stock $711.00 $498.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA00079
Chemical Name: N-(4-(n-(4,6-dimethylpyrimidin-2-yl)sulfamoyl)phenyl)acetamide
CAS Number: 100-90-3
Molecular Formula: C14H16N4O3S
Molecular Weight: 320.3668
MDL Number: MFCD00185750
SMILES: CC(=O)Nc1ccc(cc1)S(=O)(=O)Nc1nc(C)cc(n1)C

 

Upstream Synthesis Route 
  • N-Acetyl Sulfamethazine is a versatile compound commonly used in chemical synthesis due to its unique properties and reactivity. This chemical plays a crucial role in various organic reactions, particularly in the formation of sulfonamides and related compounds. Its acetyl functional group allows for precise modification and control of the reaction process, making it highly valuable in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, N-Acetyl Sulfamethazine serves as a key building block in the synthesis of complex molecular structures, enabling chemists to access a wide range of novel compounds with diverse applications.
FEATURED PRODUCTS