AE18365
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE18365 |
Chemical Name: | eucatropine |
CAS Number: | 100-91-4 |
Molecular Formula: | C17H25NO3 |
Molecular Weight: | 291.3853 |
MDL Number: | MFCD11876901 |
SMILES: | O=C(C(c1ccccc1)O)OC1CC(C)N(C(C1)(C)C)C |
Eucatropine is a powerful chemical compound that finds unique applications in the realm of chemical synthesis. Its significance lies in its ability to act as a catalyst in various synthetic reactions, leading to the efficient formation of complex molecules and compounds. When utilized in chemical synthesis, Eucatropine serves as a key component in promoting specific transformations and facilitating the creation of intricate structures. Its catalytic properties enable chemists to carry out challenging reactions with enhanced precision and control, ultimately improving the yield and purity of the desired products. Eucatropine's role in chemical synthesis underscores its importance as a versatile tool for advancing research and innovation in the field of chemistry.