logo
Home  > Eucatropine

AE18365

100-91-4 | Eucatropine

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE18365
Chemical Name: Eucatropine
CAS Number: 100-91-4
Molecular Formula: C17H25NO3
Molecular Weight: 291.3853
MDL Number: MFCD11876901
SMILES: O=C(C(c1ccccc1)O)OC1CC(C)N(C(C1)(C)C)C

 

Upstream Synthesis Route
  • Eucatropine is a powerful chemical compound that finds unique applications in the realm of chemical synthesis. Its significance lies in its ability to act as a catalyst in various synthetic reactions, leading to the efficient formation of complex molecules and compounds. When utilized in chemical synthesis, Eucatropine serves as a key component in promoting specific transformations and facilitating the creation of intricate structures. Its catalytic properties enable chemists to carry out challenging reactions with enhanced precision and control, ultimately improving the yield and purity of the desired products. Eucatropine's role in chemical synthesis underscores its importance as a versatile tool for advancing research and innovation in the field of chemistry.
FEATURED PRODUCTS