logo
Home  > N-Benzyl-N,N-dimethyl-1-phenylmethanaminium chloride

AA00078

100-94-7 | N-Benzyl-N,N-dimethyl-1-phenylmethanaminium chloride

Packsize Purity Availability Price Discounted Price    Quantity
100mg 98% 2 weeks $207.00 $145.00 -   +
250mg 98% 2 weeks $366.00 $257.00 -   +
1g 98% 2 weeks $839.00 $587.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA00078
Chemical Name: N-Benzyl-N,N-dimethyl-1-phenylmethanaminium chloride
CAS Number: 100-94-7
Molecular Formula: C16H20ClN
Molecular Weight: 261.7897
MDL Number: MFCD00031706
SMILES: C[N+](Cc1ccccc1)(Cc1ccccc1)C.[Cl-]

 

Upstream Synthesis Route 
  • Benzenemethanaminium, N,N-dimethyl-N-(phenylmethyl)-, chloride (1:1) is a versatile compound used in chemical synthesis for its ability to act as a catalyst in various reactions. Its unique chemical structure enables it to facilitate the formation of new compounds by providing a stable environment for the reaction to occur. This compound is particularly valuable in organic synthesis processes where precise control over the reaction conditions is essential. Additionally, its chloride form allows for easy handling and incorporation into different reaction setups. Its role as a catalyst in chemical synthesis opens up possibilities for the creation of a wide range of organic compounds with specific properties and applications.
FEATURED PRODUCTS