logo
Home  > Bis(trimethylsilyl)carbodiimide

AA00102

1000-70-0 | Bis(trimethylsilyl)carbodiimide

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $50.00 $35.00 -   +
5g 95% in stock $77.00 $54.00 -   +
25g 95% in stock $284.00 $199.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA00102
Chemical Name: Bis(trimethylsilyl)carbodiimide
CAS Number: 1000-70-0
Molecular Formula: C7H18N2Si2
Molecular Weight: 186.4022
MDL Number: MFCD00051538
SMILES: C[Si](N=C=N[Si](C)(C)C)(C)C

 

Upstream Synthesis Route 
  • N,N'-Methanediylidenebis(1,1,1-trimethylsilanamine) plays a crucial role in chemical synthesis as a versatile reagent with unique properties. This compound serves as an effective stabilizing agent and catalyst in various organic transformations, particularly in the field of organometallic chemistry. Its ability to coordinate with transition metals enables it to facilitate a range of complex reactions, including cross-coupling, asymmetric synthesis, and catalytic processes. Additionally, N,N'-Methanediylidenebis(1,1,1-trimethylsilanamine) is utilized in the preparation of functionalized silicon compounds, making it a valuable tool for the synthesis of advanced materials and pharmaceutical intermediates. Its distinct structure and reactivity make it a valuable component in modern chemical synthesis methodologies.
FEATURED PRODUCTS