logo
Home  > 4-Methanesulfonyl-3-pyrrolidinoaniline

AE20324

1000018-40-5 | 4-Methanesulfonyl-3-pyrrolidinoaniline

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE20324
Chemical Name: 4-Methanesulfonyl-3-pyrrolidinoaniline
CAS Number: 1000018-40-5
Molecular Formula: C11H16N2O2S
Molecular Weight: 240.3219
MDL Number: MFCD09743724
SMILES: Nc1ccc(c(c1)N1CCCC1)S(=O)(=O)C

 

Upstream Synthesis Route
  • 4-(Methylsulfonyl)-3-(1-pyrrolidinyl)benzenamine, also known as $name$, is a versatile compound widely used in chemical synthesis for its unique properties and reactivity. Its application in organic chemistry mainly revolves around its role as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and advanced materials.One of the primary uses of $name$ is as a building block in the construction of biologically active molecules. Its functional groups allow for selective modifications, enabling the synthesis of complex structures with high efficiency. Additionally, the presence of the pyrrolidine ring enhances the compound's chiral properties, making it a valuable precursor for preparing enantiomerically pure compounds.Moreover, $name$ serves as a valuable tool in the development of new drug candidates. It can be functionalized to introduce specific pharmacophores, improving the bioavailability and target specificity of potential therapeutics. The sulfone group in $name$ also offers an opportunity for further diversification through various transformations, expanding its utility in drug discovery and development.In summary, the application of 4-(Methylsulfonyl)-3-(1-pyrrolidinyl)benzenamine in chemical synthesis extends to the synthesis of pharmaceuticals, agrochemicals, and advanced materials, making it a crucial building block for designing molecules with enhanced biological activities and functional properties.
FEATURED PRODUCTS