logo
Home  > 1-(2-Methanesulfonyl-6-methoxy-phenyl)-piperazine

AE23267

1000018-42-7 | 1-(2-Methanesulfonyl-6-methoxy-phenyl)-piperazine

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE23267
Chemical Name: 1-(2-Methanesulfonyl-6-methoxy-phenyl)-piperazine
CAS Number: 1000018-42-7
Molecular Formula: C12H18N2O3S
Molecular Weight: 270.3479
MDL Number: MFCD09750908
SMILES: COc1cccc(c1N1CCNCC1)S(=O)(=O)C

 

Upstream Synthesis Route
  • 1-[2-Methoxy-6-(methylsulfonyl)phenyl]piperazine is a versatile compound widely utilized in chemical synthesis as a key building block in the creation of pharmaceuticals, agrochemicals, and advanced materials. In the field of medicinal chemistry, this compound serves as a crucial intermediate in the synthesis of various drugs targeting central nervous system disorders, such as antidepressants and antipsychotics. Its unique structure and reactivity make it an essential component in the development of novel therapeutic agents with enhanced pharmacological properties. Additionally, in the agrochemical industry, 1-[2-Methoxy-6-(methylsulfonyl)phenyl]piperazine is employed to synthesize crop protection agents that effectively control pests and diseases in agriculture. Its ability to undergo diverse chemical transformations allows for the creation of tailored molecules with specific biological activities, paving the way for advancements in both pharmaceutical and agricultural sciences.
FEATURED PRODUCTS