AE11030
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $16.00 | $12.00 | - + | |
1g | 98% | in stock | $61.00 | $43.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11030 |
Chemical Name: | N-(Boc)-6-fluoroindole-2-boronic acid |
CAS Number: | 1000068-26-7 |
Molecular Formula: | C13H15BFNO4 |
Molecular Weight: | 279.0719 |
MDL Number: | MFCD09953519 |
SMILES: | Fc1ccc2c(c1)n(C(=O)OC(C)(C)C)c(c2)B(O)O |
Complexity: | 374 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
The (1-(tert-Butoxycarbonyl)-6-fluoro-2-indolyl)boronic acid is a versatile compound that finds widespread application in chemical synthesis. It serves as a valuable building block in the preparation of various functional molecules due to its unique structural properties.This compound is commonly utilized in Suzuki-Miyaura cross-coupling reactions, where it acts as a boronic acid precursor. The presence of the boronic acid functionality allows for efficient coupling with aryl halides or triflates, leading to the formation of biaryl compounds. This reaction is widely employed in the synthesis of pharmaceuticals, agrochemicals, and materials science.Furthermore, the tert-butoxycarbonyl (Boc) protecting group in the molecule serves to control the reactivity of the indole ring during synthetic transformations. The Boc group can be selectively removed under mild conditions, enabling further functionalization of the molecule. This feature makes (1-(tert-Butoxycarbonyl)-6-fluoro-2-indolyl)boronic acid a valuable tool in the construction of complex organic structures.Overall, the versatility of this compound makes it a valuable asset in the toolbox of synthetic chemists for the efficient and controlled synthesis of diverse molecular architectures.