1000160-74-6 | 2-(Benzo[b]thiophen-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Packsize	Purity	Availability	Price	Discounted Price
100mg	98%	in stock	$182.00	$127.00
250mg	98%	in stock	$328.00	$229.00
1g	98%	in stock	$852.00	$596.00

Description

• Catalog Number: AE11886
• Chemical Name: 2-(Benzo[b]thiophen-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
• CAS Number: 1000160-74-6
• Molecular Formula: C14H17BO2S
• Molecular Weight: 260.1596
• MDL Number: MFCD16995819
• SMILES: CC1(C)OB(OC1(C)C)c1cccc2c1scc2

Upstream Synthesis Route

The 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b]thiophene is a valuable reagent commonly employed in chemical synthesis for various purposes. This compound plays a crucial role in organic chemistry as a key building block for the synthesis of complex organic molecules. Due to its unique structure and reactivity, it acts as a versatile substrate in the formation of carbon-carbon and carbon-heteroatom bonds through various cross-coupling reactions.One of the primary applications of this compound is in palladium-catalyzed coupling reactions, such as Suzuki-Miyaura coupling, Heck reaction, and Sonogashira coupling. These reactions allow for the efficient formation of aryl-aryl, aryl-vinyl, and aryl-alkyl bonds, facilitating the synthesis of biaryl compounds, functionalized heterocycles, and natural products. Additionally, the 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b]thiophene can participate in sequential functionalization strategies, enabling the rapid diversification of molecular structures in a controlled manner.Moreover, this reagent is widely utilized in the pharmaceutical industry for the synthesis of drug candidates and bioactive molecules. Its ability to introduce functional groups and modulate molecular properties makes it a valuable tool in medicinal chemistry research. Overall, the 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b]thiophene serves as a reliable and efficient building block in chemical synthesis, offering synthetic chemists a powerful means to access structurally diverse and complex organic compounds.