logo
Home  > 1-(4-Cyano-2-fluorophenyl)piperidine-3-carboxylic acid

AE20662

1000339-81-0 | 1-(4-Cyano-2-fluorophenyl)piperidine-3-carboxylic acid

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE20662
Chemical Name: 1-(4-Cyano-2-fluorophenyl)piperidine-3-carboxylic acid
CAS Number: 1000339-81-0
Molecular Formula: C13H13FN2O2
Molecular Weight: 248.2529
MDL Number: MFCD09750918
SMILES: N#Cc1ccc(c(c1)F)N1CCCC(C1)C(=O)O

 

Upstream Synthesis Route 
  • The 1-(4-Cyano-2-fluorophenyl)-3-piperidinecarboxylic acid is a versatile compound commonly utilized in chemical synthesis as a key building block. This compound is integral for the creation of various pharmaceuticals, agrochemicals, and functional materials due to its unique structural properties. In chemical synthesis, it serves as a crucial intermediate in the production of diverse organic compounds, facilitating the construction of complex molecular structures. Its distinct chemical reactivity and compatibility make it a valuable tool in the synthesis of novel compounds with enhanced functionalities and diverse applications in the field of chemistry.
FEATURED PRODUCTS