AI04778
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $246.00 | $172.00 | - + | |
250mg | 95% | in stock | $460.00 | $322.00 | - + | |
1g | 95% | in stock | $1,303.00 | $912.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI04778 |
Chemical Name: | Methyl 2-(5-cyanobenzo[b]thiophen-2-yl)acetate |
CAS Number: | 1000340-05-5 |
Molecular Formula: | C12H9NO2S |
Molecular Weight: | 231.2704 |
MDL Number: | MFCD09910410 |
SMILES: | COC(=O)Cc1cc2c(s1)ccc(c2)C#N |
Methyl 2-(5-cyanobenzo[b]thiophen-2-yl)acetate is a versatile compound that finds wide application in chemical synthesis processes. This compound serves as a key intermediate in the production of pharmaceuticals, agrochemicals, and various fine chemicals.In chemical synthesis, Methyl 2-(5-cyanobenzo[b]thiophen-2-yl)acetate can be utilized as a building block for the construction of complex organic molecules. Its unique molecular structure allows for the introduction of functional groups and structural modifications, making it valuable for the creation of novel compounds with specific properties.This compound is particularly useful in the development of bioactive molecules due to its potential for pharmacological applications. By incorporating Methyl 2-(5-cyanobenzo[b]thiophen-2-yl)acetate into synthetic pathways, chemists can access new drug candidates, pesticides, and other biologically active substances.Furthermore, the presence of the cyanobenzo[b]thiophene motif in this compound imparts interesting properties that can be harnessed in materials science and organic electronics. Its compatibility with various synthetic methodologies makes it a versatile tool for researchers aiming to explore the frontier of chemical innovation.Overall, Methyl 2-(5-cyanobenzo[b]thiophen-2-yl)acetate is a valuable asset in the toolkit of synthetic chemists, enabling the efficient synthesis of diverse molecules with potential applications across multiple sectors of the chemical industry.