AA00298
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $125.00 | $88.00 | - + | |
250mg | 95% | in stock | $167.00 | $117.00 | - + | |
500mg | 95% | in stock | $278.00 | $194.00 | - + | |
1g | 95% | in stock | $433.00 | $303.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA00298 |
Chemical Name: | 3-Iodo-4-nitro-1h-pyrrolo[2,3-b]pyridine |
CAS Number: | 1000340-40-8 |
Molecular Formula: | C7H4IN3O2 |
Molecular Weight: | 289.03002999999995 |
MDL Number: | MFCD09880134 |
SMILES: | [O-][N+](=O)c1ccnc2c1c(I)c[nH]2 |
3-Iodo-4-nitro-1H-pyrrolo[2,3-b]pyridine is a versatile compound widely used in chemical synthesis. With its unique structural properties, this compound serves as a valuable building block in the production of various complex molecules. In organic synthesis, 3-Iodo-4-nitro-1H-pyrrolo[2,3-b]pyridine can be employed as a key intermediate for the preparation of pharmaceuticals, agrochemicals, and materials science products. Its reactivity allows for the introduction of functional groups and structural modifications to tailor the properties of the final product. This compound plays a crucial role in modern chemistry by enabling the creation of novel compounds with diverse applications across different industries.