logo
Home  > 6-Bromo-1h-pyrrolo[3,2-c]pyridine-3-carboxylic acid

AA00463

1000341-77-4 | 6-Bromo-1h-pyrrolo[3,2-c]pyridine-3-carboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $117.00 $82.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA00463
Chemical Name: 6-Bromo-1h-pyrrolo[3,2-c]pyridine-3-carboxylic acid
CAS Number: 1000341-77-4
Molecular Formula: C8H5BrN2O2
Molecular Weight: 241.0415
MDL Number: MFCD09749989
SMILES: Brc1ncc2c(c1)[nH]cc2C(=O)O

 

Upstream Synthesis Route 
  • 6-Bromo-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid is a versatile compound used in various chemical synthesis applications due to its unique structure and reactivity. In the field of organic chemistry, this compound serves as a valuable building block for the synthesis of complex molecules and pharmaceutical intermediates. Its bromo substituent provides a handle for further functionalization through various cross-coupling reactions, allowing for the introduction of different functional groups. Additionally, the carboxylic acid functionality enables easy derivatization and modification, making it a useful starting material for the preparation of diverse chemical compounds. This compound plays a crucial role in the development of new drugs, agrochemicals, and materials by enabling the construction of intricate molecular architectures in a controlled and efficient manner.
FEATURED PRODUCTS