AX46862
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | in stock | $478.00 | $335.00 | - + | ||
5mg | in stock | $1,400.00 | $980.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX46862 |
Chemical Name: | gastric inhibitory polypeptide (human)-Asn-Ile-Thr-Gln-OH |
CAS Number: | 100040-31-1 |
Molecular Formula: | C226H338N60O66S |
Molecular Weight: | 4983.5293 |
MDL Number: | MFCD00081634 |
SMILES: | NCCCC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CCC(=O)N)[C@H](O)C)[C@H](CC)C)CC(=O)N)Cc1[nH]cnc1)CCCCN)Cc1c[nH]c2c1cccc2)CC(=O)O)CC(=O)N)CCCCN)CCCCN)CCCCN)CCC(=O)N)C)CC(C)C)CC(C)C)Cc1c[nH]c2c1cccc2)CC(=O)N)C(C)C)Cc1ccccc1)CC(=O)O)CCC(=O)N)CCC(=O)N)Cc1[nH]cnc1)[C@H](CC)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]([C@H](CC)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]([C@H](CC)C)NC(=O)[C@@H](NC(=O)[C@H]([C@H](O)C)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(cc1)O)N)C)CCC(=O)O)Cc1ccccc1)CO)CC(=O)O)Cc1ccc(cc1)O)CO)C)CCSC)CC(=O)O |
Gastric inhibitory polypeptide (human), also known as GIP, is commonly utilized in various chemical synthesis applications due to its ability to regulate glucose metabolism and enhance insulin secretion. In organic chemistry, GIP can be used as a key component in the development of novel drug delivery systems for diabetic patients, as its interactions with pancreatic beta cells play a crucial role in maintaining glucose homeostasis. Additionally, GIP can be incorporated into bioconjugates and peptide-based therapeutics to enhance their efficacy and targeted delivery to specific tissues within the body. Leveraging the unique biological functions of GIP in chemical synthesis presents promising opportunities for the development of advanced diabetes treatments and precision medicine solutions.