logo
Home  > 2-(4-Methyl-3-(trifluoromethyl)phenyl)acetic acid

AA00719

1000544-72-8 | 2-(4-Methyl-3-(trifluoromethyl)phenyl)acetic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $58.00 $40.00 -   +
250mg 95% in stock $82.00 $57.00 -   +
1g 95% in stock $139.00 $97.00 -   +
5g 95% in stock $395.00 $276.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA00719
Chemical Name: 2-(4-Methyl-3-(trifluoromethyl)phenyl)acetic acid
CAS Number: 1000544-72-8
Molecular Formula: C10H9F3O2
Molecular Weight: 218.1725
MDL Number: MFCD09832293
SMILES: OC(=O)Cc1ccc(c(c1)C(F)(F)F)C

 

Upstream Synthesis Route 
  • 4-Methyl-3-(trifluoromethyl)phenylacetic acid is a versatile compound widely utilized in chemical synthesis due to its unique chemical properties. In organic synthesis, it serves as a key building block for the preparation of various advanced materials and pharmaceutical intermediates. Its trifluoromethyl group confers enhanced lipophilicity and electron-withdrawing properties, making it valuable in drug discovery and development processes. Additionally, the presence of a methyl group allows for facile derivatization, enabling the synthesis of diverse derivatives with tailored properties. Furthermore, 4-Methyl-3-(trifluoromethyl)phenylacetic acid is commonly employed in the modification of biomolecules and in the construction of complex molecular frameworks, highlighting its significance in the field of chemical synthesis.
FEATURED PRODUCTS