1000546-18-8 | 2-(2-Methyl-3-(trifluoromethyl)phenyl)acetic acid

Packsize	Purity	Availability	Price	Discounted Price
1g		in stock	$233.00	$163.00

Description

• Catalog Number: AE20190
• Chemical Name: 2-(2-Methyl-3-(trifluoromethyl)phenyl)acetic acid
• CAS Number: 1000546-18-8
• Molecular Formula: C10H9F3O2
• Molecular Weight: 218.1725
• MDL Number: MFCD09832279
• SMILES: OC(=O)Cc1cccc(c1C)C(F)(F)F

Upstream Synthesis Route

2-Methyl-3-(trifluoromethyl)phenylacetic acid, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. This compound serves as a key intermediate in the preparation of pharmaceuticals and agrochemicals due to its unique chemical properties. Specifically, $name$ is utilized in the synthesis of various organic compounds, including pharmaceutical drugs, pesticides, and herbicides.One important application of 2-Methyl-3-(trifluoromethyl)phenylacetic acid in chemical synthesis is its role in the formation of complex molecular structures through reactions such as esterification, amidation, and oxidation. Its trifluoromethyl functional group enhances the chemical reactivity and stability of the molecule, allowing for efficient transformations into desired products. Additionally, the presence of the methyl and phenyl groups provides multiple points for derivatization, enabling the synthesis of diverse compounds with tailored properties.In pharmaceutical synthesis, 2-Methyl-3-(trifluoromethyl)phenylacetic acid is often used to introduce specific functionalities or structural motifs into drug candidates, enhancing their bioactivity or pharmacokinetic profiles. Its application in agrochemical synthesis allows for the preparation of crop protection agents with improved efficiency and selectivity. Overall, the versatility of $name$ makes it a valuable tool in modern chemical synthesis for the development of novel compounds with potential applications in the pharmaceutical and agricultural industries.