logo
Home  > tert-Butyl 1-benzylazetidin-3-ylcarbamate

AA00798

1000577-78-5 | tert-Butyl 1-benzylazetidin-3-ylcarbamate

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $41.00 $29.00 -   +
5g 95% in stock $99.00 $69.00 -   +
10g 95% in stock $175.00 $122.00 -   +
25g 95% in stock $355.00 $248.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA00798
Chemical Name: tert-Butyl 1-benzylazetidin-3-ylcarbamate
CAS Number: 1000577-78-5
Molecular Formula: C15H22N2O2
Molecular Weight: 262.3474
MDL Number: MFCD09878667
SMILES: O=C(OC(C)(C)C)NC1CN(C1)Cc1ccccc1

 

Upstream Synthesis Route 
  • The tert-Butyl (1-benzylazetidin-3-yl)carbamate is a versatile compound used in chemical synthesis for the protection of amino groups. This compound plays a crucial role in organic chemistry by providing a temporary shield for primary and secondary amino groups, preventing undesired reactions while allowing specific reactions to take place. By selectively blocking amino groups, tert-Butyl (1-benzylazetidin-3-yl)carbamate enables chemists to efficiently manipulate and functionalize molecules, leading to the synthesis of complex organic compounds with precision and control. This compound is indispensable in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals where the protection of amino groups is required to achieve desired chemical transformations.
FEATURED PRODUCTS