10007-84-8 | Sodium 2,6-dichlorobenzoate

Packsize	Purity	Availability	Price	Discounted Price
1g	95%	in stock	$26.00	$18.00
5g	95%	in stock	$31.00	$22.00
25g	95%	in stock	$78.00	$54.00
100g	95%	in stock	$240.00	$168.00

Description

• Catalog Number: AA00861
• Chemical Name: Sodium 2,6-dichlorobenzoate
• CAS Number: 10007-84-8
• Molecular Formula: C7H3Cl2NaO2
• Molecular Weight: 212.9933
• MDL Number: MFCD03265334
• SMILES: [O-]C(=O)c1c(Cl)cccc1Cl.[Na+]

Upstream Synthesis Route

Sodium 2,6-dichlorobenzoate, a white crystalline powder, is a key chemical reagent employed in various chemical synthesis processes. This compound plays a crucial role in the production of organic compounds and pharmaceutical intermediates due to its unique chemical properties.One of the primary applications of Sodium 2,6-dichlorobenzoate in chemical synthesis is as a building block in the formation of complex organic molecules. It serves as a versatile starting material for the synthesis of derivatives with diverse functional groups, allowing chemists to tailor the structure and properties of the final products.Furthermore, Sodium 2,6-dichlorobenzoate is commonly used as a reagent in esterification and condensation reactions. Its ability to undergo nucleophilic substitution reactions makes it a valuable component in the formation of esters, amides, and other organic functional groups. Additionally, Sodium 2,6-dichlorobenzoate is utilized in the preparation of specialty chemicals and agrochemicals, where its unique structure and reactivity contribute to the synthesis of compounds with specific biological activities. Its role in chemical synthesis extends to the development of new materials, pharmaceuticals, and fine chemicals, demonstrating its significance in modern organic chemistry research and industry.