1001242-71-2 | 8H-Imidazo[4,5-g]quinazolin-8-one, 2,6-diamino-3,7-dihydro-

Availability
Typically In Stock

Description

• Catalog Number: AA01110
• Chemical Name: 8H-Imidazo[4,5-g]quinazolin-8-one, 2,6-diamino-3,7-dihydro-
• CAS Number: 1001242-71-2
• Molecular Formula: C9H8N6O
• Molecular Weight: 216.1994
• MDL Number: MFCD29069568
• SMILES: Nc1[nH]c2c(n1)cc1c(c2)nc([nH]c1=O)N

Upstream Synthesis Route

2,6-Diamino-3H-imidazo[4,5-g]quinazolin-8(7H)-one is a versatile compound widely used in chemical synthesis as a key building block for the creation of various pharmaceuticals, agrochemicals, and materials. This compound plays a crucial role in the development of new drugs and chemical entities due to its unique molecular structure and reactivity.One of the primary applications of 2,6-Diamino-3H-imidazo[4,5-g]quinazolin-8(7H)-one in chemical synthesis is its use as a core scaffold for the synthesis of biologically active molecules. By functionalizing different positions on the imidazoquinazolinone ring system, chemists can modulate the compound's properties and biological activities. This enables the creation of novel drugs with improved efficacy, selectivity, and reduced side effects.Furthermore, 2,6-Diamino-3H-imidazo[4,5-g]quinazolin-8(7H)-one can be employed as a ligand in transition metal-catalyzed reactions, facilitating the formation of complex organic molecules with high efficiency and selectivity. Its versatile nature allows for the development of diverse synthetic methodologies, making it a valuable tool in the construction of molecular libraries for drug discovery and material science.In summary, the incorporation of 2,6-Diamino-3H-imidazo[4,5-g]quinazolin-8(7H)-one in chemical synthesis paves the way for the creation of innovative compounds with potential applications in various fields, ranging from medicine to materials science.