logo
Home  > Z-D-Allo-thr(tbu)-oh dcha

AE21127

100157-55-9 | Z-D-Allo-thr(tbu)-oh dcha

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $130.00 $91.00 -   +
250mg 95% in stock $137.00 $96.00 -   +
1g 95% in stock $297.00 $208.00 -   +
5g 95% in stock $1,069.00 $748.00 -   +
10g 95% in stock $1,535.00 $1,074.00 -   +
25g 95% in stock $2,810.00 $1,967.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE21127
Chemical Name: Z-D-Allo-thr(tbu)-oh dcha
CAS Number: 100157-55-9
Molecular Formula: C28H46N2O5
Molecular Weight: 490.6752
MDL Number: MFCD08458676
SMILES: C1CCC(CC1)NC1CCCCC1.C[C@H]([C@H](C(=O)O)NC(=O)OCc1ccccc1)OC(C)(C)C

 

Upstream Synthesis Route 
  • The (2R,3R)-2-(((Benzyloxy)carbonyl)amino)-3-(tert-butoxy)butanoic acid is a valuable compound in chemical synthesis, especially in peptide chemistry and drug development. This specific acid derivative serves as a key building block in the creation of peptide chains due to its unique structural features and reactivity. In chemical synthesis, this compound can be used as a protected amino acid, where the benzyloxycarbonyl (Cbz) protecting group shields the amino group from undesired reactions until it is selectively removed at a later stage. Additionally, the tert-butoxy group provides steric hindrance, which can be advantageous in controlling the overall conformation of the synthesized peptide. Ultimately, the (2R,3R)-2-(((Benzyloxy)carbonyl)amino)-3-(tert-butoxy)butanoic acid plays a crucial role in the efficient and precise assembly of peptide structures for various applications in medicinal chemistry and biochemistry.
FEATURED PRODUCTS