logo
Home  > N-Acetyl-alpha-d-glucosamine

AA02040

10036-64-3 | N-Acetyl-alpha-d-glucosamine

Packsize Purity Availability Price Discounted Price    Quantity
1g 99% in stock $39.00 $27.00 -   +
5g 99% in stock $115.00 $80.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA02040
Chemical Name: N-Acetyl-alpha-d-glucosamine
CAS Number: 10036-64-3
Molecular Formula: C8H15NO6
Molecular Weight: 221.2078
MDL Number: MFCD00064359
SMILES: OC[C@H]1O[C@H](O)[C@@H]([C@H]([C@@H]1O)O)NC(=O)C

 

Upstream Synthesis Route 
  • N-((2S,3R,4R,5S,6R)-2,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-3-yl)acetamide is a valuable compound in chemical synthesis due to its versatile applications. In organic chemistry, it serves as a crucial building block for the preparation of various complex molecules. Its hydroxyl groups enable it to participate in reactions such as acylation, alkylation, and condensation, leading to the formation of diverse chemical structures. Additionally, the unique tetrahydropyran ring system confers stability and rigidity to the molecule, making it ideal for use in the synthesis of natural products and pharmaceutical intermediates. By incorporating N-((2S,3R,4R,5S,6R)-2,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-3-yl)acetamide into synthetic pathways, chemists can access a wide array of functionalized compounds with enhanced biological activities and physical properties.
FEATURED PRODUCTS