BI30579
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $154.00 | $108.00 | - + | |
250mg | 97% | in stock | $230.00 | $161.00 | - + | |
1g | 97% | in stock | $577.00 | $404.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BI30579 |
Chemical Name: | (4S,4'S)-2,2'-(Cyclopropane-1,1-diyl)bis(4-benzyl-4,5-dihydrooxazole) |
CAS Number: | 1003886-01-8 |
Molecular Formula: | C23H24N2O2 |
Molecular Weight: | 360.4489 |
MDL Number: | MFCD16556148 |
SMILES: | C1OC(=N[C@H]1Cc1ccccc1)C1(CC1)C1=N[C@H](CO1)Cc1ccccc1 |
The compound (4S,4'S)-2,2'-(Cyclopropane-1,1-diyl)bis(4-benzyl-4,5-dihydrooxazole) is a versatile molecule widely utilized in chemical synthesis for the construction of complex organic frameworks. Known for its unique structural properties, this compound serves as a valuable building block in the creation of diverse molecular architectures. Its cyclopropane backbone imparts rigidity and stereochemical control, facilitating the synthesis of chiral compounds with high selectivity. In addition, the presence of oxazole rings offers reactivity and functional group compatibility, allowing for further derivatization and elaboration of molecular structures. This compound finds application in the synthesis of pharmaceuticals, natural products, and materials with precisely controlled stereochemistry and functionality. Its incorporation in multi-step synthesis routes enables the efficient construction of intricate molecular scaffolds, making it a valuable tool for organic chemists seeking to access novel compounds with specific properties and applications.