10039-33-5 | 5,7,12-Trioxa-6-stannaoctadeca-2,9-dienoic acid, 14-ethyl-6,6-dioctyl-4,8,11-trioxo-, 2-ethylhexyl ester

Availability
Typically In Stock

Description

• Catalog Number: AA02239
• Chemical Name: 5,7,12-Trioxa-6-stannaoctadeca-2,9-dienoic acid, 14-ethyl-6,6-dioctyl-4,8,11-trioxo-, 2-ethylhexyl ester
• CAS Number: 10039-33-5
• Molecular Formula: C40H72O8Sn
• Molecular Weight: 799.6959
• SMILES: CCCCCCCC[Sn](OC(=O)C=CC(=O)OCC(CCCC)CC)(OC(=O)C=CC(=O)OCC(CCCC)CC)CCCCCCCC

Upstream Synthesis Route

5,7,12-Trioxa-6-stannaoctadeca-2,9-dienoic acid, 14-ethyl-6,6-dioctyl-4,8,11-trioxo-, 2-ethylhexyl ester is a versatile compound commonly used in chemical synthesis processes. This compound serves as a crucial reagent in the production of specialized polymers and materials due to its unique chemical properties. Its application in cross-coupling reactions allows for the efficient formation of complex carbon-carbon bonds, making it valuable in the synthesis of organic molecules with desired structural features. Additionally, its use as a stabilizing agent in metal-catalyzed reactions enhances reaction efficiency and selectivity, enabling the synthesis of diverse compounds with high purity. Furthermore, the compound's ability to act as a ligand in transition metal-catalyzed processes broadens its utility in creating advanced materials for various industrial applications.