AA02350
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 99% | in stock | $108.00 | $75.00 | - + | |
10mg | 99% | in stock | $158.00 | $110.00 | - + | |
25mg | 99% | in stock | $268.00 | $187.00 | - + | |
50mg | 99% | in stock | $453.00 | $317.00 | - + | |
100mg | 99% | in stock | $772.00 | $540.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA02350 |
Chemical Name: | 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-, 3-[2-[(3,3-diphenylpropyl)methylamino]-1,1-dimethylethyl] 5-methyl ester |
CAS Number: | 100427-26-7 |
Molecular Formula: | C36H41N3O6 |
Molecular Weight: | 611.7272 |
MDL Number: | MFCD00867978 |
SMILES: | COC(=O)C1=C(C)NC(=C(C1c1cccc(c1)[N+](=O)[O-])C(=O)OC(CN(CCC(c1ccccc1)c1ccccc1)C)(C)C)C |
3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-, 3-[2-[(3,3-diphenylpropyl)methylamino]-1,1-dimethylethyl] 5-methyl ester is a versatile compound used in various chemical synthesis processes. This compound serves as a key intermediate in the production of advanced pharmaceuticals, agrochemicals, and specialty chemicals. Its unique chemical structure allows it to participate in numerous reactions leading to the creation of complex organic molecules with diverse applications.One significant application of this compound is in the synthesis of novel drug candidates. By utilizing its distinct chemical properties, researchers can modify and functionalize the molecule to develop potential therapeutic agents targeting specific biological pathways. The compound's structural motifs provide opportunities for introducing various functional groups, allowing for the customization of drug molecules with desired pharmacological properties.Furthermore, this compound finds utility in the creation of specialized materials through organic synthesis. Its functional groups can be leveraged to link with other molecules or polymers, enabling the production of advanced materials with tailored properties such as improved durability, enhanced performance, or specific surface characteristics. Additionally, the compound's intermediate nature makes it a valuable building block for the construction of intricate molecular architectures in materials science.Overall, the application of 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-, 3-[2-[(3,3-diphenylpropyl)methylamino]-1,1-dimethylethyl] 5-methyl ester in chemical synthesis is instrumental in the development of cutting-edge compounds for pharmaceutical, agrochemical, and materials science industries, showcasing its importance as a key component in the synthesis of diverse and impactful chemical products.