logo
Home  > 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-, 3-[2-[(3,3-diphenylpropyl)methylamino]-1,1-dimethylethyl] 5-methyl ester

AA02350

100427-26-7 | 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-, 3-[2-[(3,3-diphenylpropyl)methylamino]-1,1-dimethylethyl] 5-methyl ester

Packsize Purity Availability Price Discounted Price    Quantity
5mg 99% in stock $108.00 $75.00 -   +
10mg 99% in stock $158.00 $110.00 -   +
25mg 99% in stock $268.00 $187.00 -   +
50mg 99% in stock $453.00 $317.00 -   +
100mg 99% in stock $772.00 $540.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA02350
Chemical Name: 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-, 3-[2-[(3,3-diphenylpropyl)methylamino]-1,1-dimethylethyl] 5-methyl ester
CAS Number: 100427-26-7
Molecular Formula: C36H41N3O6
Molecular Weight: 611.7272
MDL Number: MFCD00867978
SMILES: COC(=O)C1=C(C)NC(=C(C1c1cccc(c1)[N+](=O)[O-])C(=O)OC(CN(CCC(c1ccccc1)c1ccccc1)C)(C)C)C

 

Upstream Synthesis Route
  • 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-, 3-[2-[(3,3-diphenylpropyl)methylamino]-1,1-dimethylethyl] 5-methyl ester is a versatile compound used in various chemical synthesis processes. This compound serves as a key intermediate in the production of advanced pharmaceuticals, agrochemicals, and specialty chemicals. Its unique chemical structure allows it to participate in numerous reactions leading to the creation of complex organic molecules with diverse applications.One significant application of this compound is in the synthesis of novel drug candidates. By utilizing its distinct chemical properties, researchers can modify and functionalize the molecule to develop potential therapeutic agents targeting specific biological pathways. The compound's structural motifs provide opportunities for introducing various functional groups, allowing for the customization of drug molecules with desired pharmacological properties.Furthermore, this compound finds utility in the creation of specialized materials through organic synthesis. Its functional groups can be leveraged to link with other molecules or polymers, enabling the production of advanced materials with tailored properties such as improved durability, enhanced performance, or specific surface characteristics. Additionally, the compound's intermediate nature makes it a valuable building block for the construction of intricate molecular architectures in materials science.Overall, the application of 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-, 3-[2-[(3,3-diphenylpropyl)methylamino]-1,1-dimethylethyl] 5-methyl ester in chemical synthesis is instrumental in the development of cutting-edge compounds for pharmaceutical, agrochemical, and materials science industries, showcasing its importance as a key component in the synthesis of diverse and impactful chemical products.
FEATURED PRODUCTS