logo
Home  > (E)-4-(2-Nitrovinyl)pyridine

AE55713

100446-37-5 | (E)-4-(2-Nitrovinyl)pyridine

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $99.00 $69.00 -   +
1g 95% in stock $255.00 $178.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE55713
Chemical Name: (E)-4-(2-Nitrovinyl)pyridine
CAS Number: 100446-37-5
Molecular Formula: C7H6N2O2
Molecular Weight: 150.13474
MDL Number: MFCD11878108
SMILES: [O-][N+](=O)/C=C/c1ccncc1

 

Upstream Synthesis Route 
  • 4-[(1E)-2-Nitroethenyl]pyridine is a versatile compound widely utilized in chemical synthesis for its unique properties. In organic chemistry, it serves as a key building block for the synthesis of various complex molecules and pharmaceuticals. This compound's nitro group plays a crucial role in facilitating diverse reactions such as nucleophilic substitution, reduction, and palladium-catalyzed cross-coupling reactions. Additionally, the presence of the conjugated double bond offers opportunities for further functionalization through selective modifications. Its application in the creation of novel materials and fine chemicals highlights its significance in the realm of chemical synthesis.
FEATURED PRODUCTS