AD48294
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD48294 |
Chemical Name: | 1H-Benzimidazolium,5,6-dichloro-2-[3-[5,6-dichloro-1-ethyl-1,3-dihydro-3-(4-sulfobutyl)-2H-benzimidazol-2-ylidene]-1-propen-1-yl]-1-ethyl-3-(4-sulfobutyl)-,inner salt |
CAS Number: | 10049-96-4 |
Molecular Formula: | C29H34Cl4N4O6S2 |
Molecular Weight: | 740.5455 |
MDL Number: | MFCD03093268 |
SMILES: | CCN1C(=CC=Cc2[n+](CCCCS(=O)(=O)[O-])c3c(n2CC)cc(c(c3)Cl)Cl)N(c2c1cc(Cl)c(c2)Cl)CCCCS(=O)(=O)O |
The 1H-Benzimidazolium,5,6-dichloro-2-[3-[5,6-dichloro-1-ethyl-1,3-dihydro-3-(4-sulfobutyl)-2H-benzimidazol-2-ylidene]-1-propen-1-yl]-1-ethyl-3-(4-sulfobutyl)-,inner salt is a versatile compound widely utilized in chemical synthesis. This compound is particularly valuable in the field of organic chemistry for its ability to act as a catalyst in various reactions. Its unique structure allows it to facilitate the formation of complex molecules by promoting key bond formations and structural rearrangements. Researchers and chemists often employ this compound in the construction of new chemical entities and the modification of existing compounds to enhance their properties. Its role in chemical synthesis extends to diverse applications, including the development of pharmaceuticals, agrochemicals, and materials with tailored functionalities.