BD79368
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BD79368 |
Chemical Name: | Thiazolium, 3-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-2-(1-hydroxyethyl)-4-methyl-5-(4,6,6-trihydroxy-4,6-dioxido-3,5-dioxa-4,6-diphosphahex-1-yl)- |
CAS Number: | 10055-47-7 |
Molecular Formula: | C14H23N4O8P2S |
Molecular Weight: | 469.3669 |
SMILES: | Cc1ncc(c(n1)N)C[n+]1c(C)c(sc1C(O)C)CCOP(=O)(OP(=O)(O)O)O |
2-(α-Hydroxyethyl)thiamine diphosphate, also known as THDP, is a crucial coenzyme involved in various biochemical pathways, particularly in chemical synthesis. In the realm of organic chemistry, THDP serves as a valuable catalyst in promoting key reactions that are essential for the production of a wide range of compounds. Its unique structure and reactivity make it a versatile tool for organic chemists looking to streamline complex synthetic processes. THDP's ability to facilitate carbon-carbon bond formation and promote redox reactions makes it indispensable in the creation of pharmaceuticals, agrochemicals, and other specialty compounds. Its role in catalyzing key steps in the metabolism of carbohydrates further underscores its significance in chemical synthesis and highlights its potential for applications in both academic research and industrial settings.