AA03176
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | 2 weeks | $266.00 | $186.00 | - + | |
5mg | 95% | 2 weeks | $280.00 | $196.00 | - + | |
10mg | 95% | 2 weeks | $307.00 | $215.00 | - + | |
500mg | 95% | 2 weeks | $426.00 | $298.00 | - + | |
1g | 95% | 2 weeks | $644.00 | $451.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA03176 |
Chemical Name: | N-Benzyl-4-chloro-2-nitroaniline |
CAS Number: | 10066-18-9 |
Molecular Formula: | C13H11ClN2O2 |
Molecular Weight: | 262.6916 |
MDL Number: | MFCD01051337 |
SMILES: | Clc1ccc(c(c1)[N+](=O)[O-])NCc1ccccc1 |
N-Benzyl-4-chloro-2-nitroaniline is a versatile compound that finds application in various chemical synthesis processes. This particular compound serves as a key intermediate in the production of several important chemicals, including pharmaceuticals, dyes, and agrochemicals. Its unique chemical structure and reactivity make it useful for carrying out various transformations and functional group modifications in organic synthesis.In pharmaceutical chemistry, N-Benzyl-4-chloro-2-nitroaniline can be used in the synthesis of biologically active compounds and drug candidates. Its presence in the molecular structure of a drug molecule can impart specific desired properties or activities. Additionally, this compound can be utilized in the preparation of molecular probes and fluorescent labels for biological studies and diagnostics.In the field of dye synthesis, N-Benzyl-4-chloro-2-nitroaniline serves as a valuable building block for creating a wide range of colorful and functional dyes. By selectively modifying its chemical structure, chemists can tailor the properties of the resulting dye molecules, such as color, solubility, and stability. This compound plays a crucial role in developing new dye formulations with improved performance characteristics.Furthermore, in agrochemical research and development, N-Benzyl-4-chloro-2-nitroaniline can be incorporated into the synthesis of pesticides, herbicides, and insecticides. Its presence in the molecular structure of these agricultural chemicals can enhance their biological activity, selectivity, and environmental safety profile. This compound's role in agrochemical synthesis contributes to the development of effective crop protection products for sustainable agriculture.Overall, the versatile nature of N-Benzyl-4-chloro-2-nitroaniline makes it a valuable asset in chemical synthesis, enabling the creation of diverse compounds with applications across different industries.