logo
Home  > 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperidin-2-one

AI05019

1007346-42-0 | 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperidin-2-one

Packsize Purity Availability Price Discounted Price    Quantity
100mg 96% in stock $249.00 $175.00 -   +
250mg 96% in stock $401.00 $281.00 -   +
1g 96% in stock $1,022.00 $716.00 -   +
5g 96% in stock $4,053.00 $2,837.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AI05019
Chemical Name: 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperidin-2-one
CAS Number: 1007346-42-0
Molecular Formula: C17H24BNO3
Molecular Weight: 301.1884
MDL Number: MFCD22415355
SMILES: O=C1CCCCN1c1ccc(cc1)B1OC(C(O1)(C)C)(C)C

 

Computed Properties
Complexity: 414  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 22  
Hydrogen Bond Acceptor Count: 3  
Rotatable Bond Count: 2  

 

 

Upstream Synthesis Route 
  • The compound 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperidin-2-one plays a crucial role in chemical synthesis as a versatile building block. It serves as a key intermediate for the formation of various organic compounds due to its unique structural features. This compound is particularly valued for its ability to participate in Suzuki-Miyaura cross-coupling reactions, enabling the efficient construction of complex molecular structures. Additionally, its functional groups facilitate further derivatization, making it a valuable tool for the synthesis of pharmaceuticals, agrochemicals, and advanced materials.
FEATURED PRODUCTS