AA03672
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 97% | in stock | $86.00 | $60.00 | - + | |
100mg | 97% | in stock | $122.00 | $85.00 | - + | |
250mg | 97% | in stock | $236.00 | $165.00 | - + | |
1g | 97% | in stock | $500.00 | $350.00 | - + | |
5g | 97% | in stock | $1,749.00 | $1,224.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA03672 |
Chemical Name: | Bis(2,5-dioxopyrrolidin-1-yl) 4,7,10,13,16,19,22,25,28-nonaoxahentriacontane-1,31-dioate |
CAS Number: | 1008402-79-6 |
Molecular Formula: | C30H48N2O17 |
Molecular Weight: | 708.7053 |
MDL Number: | MFCD11041131 |
SMILES: | O=C(ON1C(=O)CCC1=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
The compound bis(2,5-dioxopyrrolidin-1-yl) 4,7,10,13,16,19,22,25,28-nonaoxahentriacontane-1,31-dioate (name) is commonly used in chemical synthesis as a versatile building block. Its unique structure allows for the introduction of multiple functional groups, making it valuable in the construction of complex molecular architectures. By incorporating this compound into synthetic pathways, chemists can efficiently create a wide range of novel compounds with tailored properties and applications.