logo
Home  > Carbamic acid, N,N'-[[1,1'-biphenyl]-4,4'-diylbis[1H-imidazole-5,2-diyl-(2S)-2,1-pyrrolidinediyl[(1S)-1-(1-methylethyl)-2-oxo-2,1-ethanediyl]]]bis-, C,C'-dimethyl ester

AA03924

1009119-64-5 | Carbamic acid, N,N'-[[1,1'-biphenyl]-4,4'-diylbis[1H-imidazole-5,2-diyl-(2S)-2,1-pyrrolidinediyl[(1S)-1-(1-methylethyl)-2-oxo-2,1-ethanediyl]]]bis-, C,C'-dimethyl ester

Packsize Purity Availability Price Discounted Price    Quantity
100mg 98% in stock $56.00 $40.00 -   +
250mg 98% in stock $91.00 $64.00 -   +
1g 98% in stock $323.00 $226.00 -   +
5g 98% in stock $1,129.00 $791.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA03924
Chemical Name: Carbamic acid, N,N'-[[1,1'-biphenyl]-4,4'-diylbis[1H-imidazole-5,2-diyl-(2S)-2,1-pyrrolidinediyl[(1S)-1-(1-methylethyl)-2-oxo-2,1-ethanediyl]]]bis-, C,C'-dimethyl ester
CAS Number: 1009119-64-5
Molecular Formula: C40H50N8O6
Molecular Weight: 738.875
MDL Number: MFCD18074519
SMILES: COC(=O)N[C@H](C(=O)N1CCC[C@H]1c1ncc([nH]1)c1ccc(cc1)c1ccc(cc1)c1cnc([nH]1)[C@@H]1CCCN1C(=O)[C@H](C(C)C)NC(=O)OC)C(C)C

 

Upstream Synthesis Route
  • Carbamic acid, N,N'-[[1,1'-biphenyl]-4,4'-diylbis[1H-imidazole-5,2-diyl-(2S)-2,1-pyrrolidinediyl[(1S)-1-(1-methylethyl)-2-oxo-2,1-ethanediyl]]]bis-, C,C'-dimethyl ester is a versatile compound widely used in chemical synthesis processes. This compound plays a crucial role as a building block in the creation of complex molecular structures. Its unique structure and properties make it an essential component for the synthesis of various organic molecules with specific functionalities.In chemical synthesis, Carbamic acid, N,N'-[[1,1'-biphenyl]-4,4'-diylbis[1H-imidazole-5,2-diyl-(2S)-2,1-pyrrolidinediyl[(1S)-1-(1-methylethyl)-2-oxo-2,1-ethanediyl]]]bis-, C,C'-dimethyl ester acts as a key intermediate that facilitates the formation of intricate chemical compounds through sequential reactions. Its presence enables the construction of complex molecular frameworks by serving as a connecting point for various functional groups. This compound's involvement in chemical synthesis processes allows for the creation of novel molecules with tailored properties and applications across different industries.Overall, Carbamic acid, N,N'-[[1,1'-biphenyl]-4,4'-diylbis[1H-imidazole-5,2-diyl-(2S)-2,1-pyrrolidinediyl[(1S)-1-(1-methylethyl)-2-oxo-2,1-ethanediyl]]]bis-, C,C'-dimethyl ester is a valuable tool in the hands of synthetic chemists, providing a basis for the development of innovative compounds through strategic chemical transformations and derivatization processes.
FEATURED PRODUCTS