AA03924
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $56.00 | $40.00 | - + | |
250mg | 98% | in stock | $91.00 | $64.00 | - + | |
1g | 98% | in stock | $323.00 | $226.00 | - + | |
5g | 98% | in stock | $1,129.00 | $791.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA03924 |
Chemical Name: | Carbamic acid, N,N'-[[1,1'-biphenyl]-4,4'-diylbis[1H-imidazole-5,2-diyl-(2S)-2,1-pyrrolidinediyl[(1S)-1-(1-methylethyl)-2-oxo-2,1-ethanediyl]]]bis-, C,C'-dimethyl ester |
CAS Number: | 1009119-64-5 |
Molecular Formula: | C40H50N8O6 |
Molecular Weight: | 738.875 |
MDL Number: | MFCD18074519 |
SMILES: | COC(=O)N[C@H](C(=O)N1CCC[C@H]1c1ncc([nH]1)c1ccc(cc1)c1ccc(cc1)c1cnc([nH]1)[C@@H]1CCCN1C(=O)[C@H](C(C)C)NC(=O)OC)C(C)C |
Carbamic acid, N,N'-[[1,1'-biphenyl]-4,4'-diylbis[1H-imidazole-5,2-diyl-(2S)-2,1-pyrrolidinediyl[(1S)-1-(1-methylethyl)-2-oxo-2,1-ethanediyl]]]bis-, C,C'-dimethyl ester is a versatile compound widely used in chemical synthesis processes. This compound plays a crucial role as a building block in the creation of complex molecular structures. Its unique structure and properties make it an essential component for the synthesis of various organic molecules with specific functionalities.In chemical synthesis, Carbamic acid, N,N'-[[1,1'-biphenyl]-4,4'-diylbis[1H-imidazole-5,2-diyl-(2S)-2,1-pyrrolidinediyl[(1S)-1-(1-methylethyl)-2-oxo-2,1-ethanediyl]]]bis-, C,C'-dimethyl ester acts as a key intermediate that facilitates the formation of intricate chemical compounds through sequential reactions. Its presence enables the construction of complex molecular frameworks by serving as a connecting point for various functional groups. This compound's involvement in chemical synthesis processes allows for the creation of novel molecules with tailored properties and applications across different industries.Overall, Carbamic acid, N,N'-[[1,1'-biphenyl]-4,4'-diylbis[1H-imidazole-5,2-diyl-(2S)-2,1-pyrrolidinediyl[(1S)-1-(1-methylethyl)-2-oxo-2,1-ethanediyl]]]bis-, C,C'-dimethyl ester is a valuable tool in the hands of synthetic chemists, providing a basis for the development of innovative compounds through strategic chemical transformations and derivatization processes.