logo
Home  > Boroxin, 2,4,6-tributoxy-

AA04244

101-36-0 | Boroxin, 2,4,6-tributoxy-

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA04244
Chemical Name: Boroxin, 2,4,6-tributoxy-
CAS Number: 101-36-0
Molecular Formula: C12H27B3O6
Molecular Weight: 299.7722
MDL Number: MFCD01317332
SMILES: CCCCOb1ob(OCCCC)ob(o1)OCCCC

 

Upstream Synthesis Route
  • Tributoxyboroxin, a boron-based compound, is a versatile reagent widely employed in chemical synthesis. Its application in organic chemistry lies primarily in its ability to serve as a catalyst in various reactions, particularly those involving the formation of carbon-carbon bonds. Tributoxyboroxin is known for its utility in promoting the creation of complex molecular structures through processes such as Suzuki coupling, Suzuki-Miyaura cross-coupling, and hydroboration reactions.Furthermore, Tributoxyboroxin has found significant use in the synthesis of pharmaceuticals, agrochemicals, and advanced materials due to its compatibility with a wide range of functional groups and its mild reaction conditions. Its role as a catalyst in these reactions enables chemists to streamline synthetic pathways, improve reaction yields, and enhance selectivity, ultimately facilitating the efficient production of target molecules with high purity and quality.
FEATURED PRODUCTS