AA04263
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $9.00 | $7.00 | - + | |
10g | 98% | in stock | $16.00 | $12.00 | - + | |
25g | 98% | in stock | $34.00 | $24.00 | - + | |
100g | 98% | in stock | $135.00 | $95.00 | - + | |
500g | 98% | in stock | $674.00 | $472.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA04263 |
Chemical Name: | 4,4'-Dimethoxydiphenylamine |
CAS Number: | 101-70-2 |
Molecular Formula: | C14H15NO2 |
Molecular Weight: | 229.2744 |
MDL Number: | MFCD00014895 |
SMILES: | COc1ccc(cc1)Nc1ccc(cc1)OC |
Complexity: | 184 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 3.6 |
ChemSusChem 20120801
Inorganic chemistry 20100517
Journal of the American Chemical Society 20031015