logo
Home  > (S)-tert-Butyl 3-(piperazin-1-yl)pyrrolidine-1-carboxylate

AA04468

1010446-31-7 | (S)-tert-Butyl 3-(piperazin-1-yl)pyrrolidine-1-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $187.00 $131.00 -   +
250mg 95% in stock $283.00 $198.00 -   +
1g 95% in stock $690.00 $483.00 -   +
5g 95% in stock $2,625.00 $1,837.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA04468
Chemical Name: (S)-tert-Butyl 3-(piperazin-1-yl)pyrrolidine-1-carboxylate
CAS Number: 1010446-31-7
Molecular Formula: C13H25N3O2
Molecular Weight: 255.3565
MDL Number: MFCD18633366
SMILES: O=C(N1CC[C@@H](C1)N1CCNCC1)OC(C)(C)C

 

Upstream Synthesis Route 
  • (S)-tert-Butyl 3-(piperazin-1-yl)pyrrolidine-1-carboxylate is a valuable compound widely used in chemical synthesis for the development of various pharmaceuticals and organic molecules. This unique compound serves as a versatile building block in the synthesis of complex molecules due to its chirality and functional groups. Its specific application lies in asymmetric synthesis, where the stereochemistry of the compound plays a crucial role in controlling the stereoselectivity of reactions. By incorporating (S)-tert-Butyl 3-(piperazin-1-yl)pyrrolidine-1-carboxylate into synthetic pathways, chemists can efficiently access enantiopure compounds with high selectivity, making it a powerful tool in the field of medicinal chemistry and drug discovery. Moreover, its structural features provide opportunities for further derivatization, enabling the creation of diverse chemical libraries and potential drug candidates.
FEATURED PRODUCTS