AA04922
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $285.00 | $199.00 | - + | |
250mg | 95% | in stock | $440.00 | $308.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA04922 |
Chemical Name: | N,N'-[(1R,2R)-1,2-Diphenyl-1,2-ethanediyl]bis[N'-[3,5-bis(trifluoromethyl)phenyl]thiourea |
CAS Number: | 1012051-90-9 |
Molecular Formula: | C32H22F12N4S2 |
Molecular Weight: | 754.6547 |
MDL Number: | MFCD31707548 |
SMILES: | S=C(Nc1cc(cc(c1)C(F)(F)F)C(F)(F)F)N[C@@H]([C@@H](c1ccccc1)NC(=S)Nc1cc(cc(c1)C(F)(F)F)C(F)(F)F)c1ccccc1 |
N,N''-[(1R,2R)-1,2-Diphenyl-1,2-ethanediyl]bis[N'-[3,5-bis(trifluoromethyl)phenyl]thiourea, commonly referred to as $name$, is a key compound utilized in chemical synthesis for its unique properties and reactivity. This molecule serves as a versatile building block in various synthetic pathways due to its ability to facilitate complex transformations in organic chemistry.In chemical synthesis, $name$ acts as a potent catalyst, enabling the formation of intricate molecular structures through a range of reactions such as cross-coupling, functional group transformations, and asymmetric catalysis. Its distinct stereochemistry and functional groups play a crucial role in directing and controlling the course of these reactions, resulting in highly selective and efficient synthetic processes.Moreover, the presence of the thiourea moiety in $name$ imparts valuable properties such as hydrogen bonding capabilities and chiral recognition, making it a valuable tool in the creation of enantioenriched compounds. This is particularly advantageous in the pharmaceutical and agrochemical industries where enantioselective synthesis is essential for the development of bioactive molecules with desired biological activity.Overall, the application of N,N''-[(1R,2R)-1,2-Diphenyl-1,2-ethanediyl]bis[N'-[3,5-bis(trifluoromethyl)phenyl]thiourea in chemical synthesis represents a sophisticated and efficient approach to constructing complex molecular architectures with high precision and control, paving the way for the creation of novel compounds with diverse applications.