AA05001
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 97% | 2 weeks | $1,039.00 | $727.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA05001 |
Chemical Name: | Kushenol L |
CAS Number: | 101236-50-4 |
Molecular Formula: | C25H28O7 |
Molecular Weight: | 440.4856 |
MDL Number: | MFCD21333762 |
SMILES: | CC(=CCc1c2O[C@H](c3ccc(cc3O)O)[C@H](C(=O)c2c(c(c1O)CC=C(C)C)O)O)C |
Kushenol L is a naturally occurring compound that has shown great potential in chemical synthesis applications. As a chemist, I understand that Kushenol L can be utilized as a valuable building block in the creation of various organic compounds. Its unique structure and reactivity make it a versatile tool for chemists seeking to design and develop novel molecules.In chemical synthesis, Kushenol L can serve as a key starting material for the construction of complex structures. Its functional groups allow for selective modifications, enabling the formation of diverse chemical bonds. Chemists can harness the reactivity of Kushenol L to introduce specific functional groups, such as alcohols, ketones, or ethers, into a target molecule. This versatility makes Kushenol L a valuable resource in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals.Furthermore, the stereochemistry of Kushenol L plays a crucial role in determining the stereochemical outcome of synthetic reactions. By carefully controlling the stereochemistry of Kushenol L during the synthesis process, chemists can access stereochemically pure compounds with high efficiency and selectivity. This feature is particularly valuable in asymmetric synthesis, where the creation of chiral compounds is essential.Overall, Kushenol L's unique structure, reactivity, and stereochemistry make it a valuable asset in the toolkit of synthetic chemists. By leveraging its properties, chemists can expedite the synthesis of complex molecules and explore new avenues in the field of organic chemistry.