AA05207
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA05207 |
Chemical Name: | 2H-Furo[3,4-b]pyran-4,7(3H,5H)-dione, 2,2,5-trimethyl- |
CAS Number: | 1013-11-2 |
Molecular Formula: | C10H12O4 |
Molecular Weight: | 196.1999 |
SMILES: | CC1OC(=O)C2=C1C(=O)CC(O2)(C)C |
2H-Furo[3,4-b]pyran-4,7(3H,5H)-dione, 2,2,5-trimethyl- is an essential compound widely used in chemical synthesis. This organic molecule serves as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals due to its unique chemical properties and reactivity. Its structure contains a furo[3,4-b]pyran core with a dione moiety, along with three methyl groups positioned at specific sites, giving it distinctive characteristics that are utilized in the synthesis of complex organic molecules. The presence of the dione group offers the potential for participating in various organic reactions, such as nucleophilic addition and condensation reactions, enabling the formation of diverse chemical compounds. Additionally, the strategically positioned methyl groups play a crucial role in influencing the compound's stereochemistry and reactivity, making it a versatile intermediate in the synthesis of complex organic structures. Its utilization in chemical synthesis contributes significantly to the development of novel compounds with potential applications in pharmaceutical, agricultural, and material science industries.