AX19679
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 98% | in stock | $226.00 | $158.00 | - + | |
25mg | 98% | in stock | $449.00 | $314.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX19679 |
Chemical Name: | Acetic acid,[[2-[[(2R)-2-amino-3-methyl-1-oxobutyl]amino]-1,1-dimethylethyl]thio]-,(3aS,4R,5S,6S,8R,9R,9aR,10R)-6-ethenyldecahydro-5-hydroxy-4,6,9,10-tetramethyl-1-oxo-3a,9-propano-3aH-cyclopentacycloocten-8-ylester |
CAS Number: | 101312-92-9 |
Molecular Formula: | C31H52N2O5S |
Molecular Weight: | 564.82 |
MDL Number: | MFCD09832850 |
SMILES: | C=C[C@]1(C)C[C@@H](OC(=O)CSC(CNC(=O)[C@@H](C(C)C)N)(C)C)[C@]2(C)[C@H](C)CC[C@]3([C@H]([C@@H]1O)C)[C@H]2C(=O)CC3 |
Valnemulin is a potent antibiotic and antiprotozoal drug that finds wide application in chemical synthesis. Its unique chemical properties make it a valuable tool in organic chemistry, particularly in the synthesis of complex molecules. By leveraging Valnemulin's versatile structure, chemists can efficiently introduce specific functional groups and stereochemical elements into their target molecules. This capability enables the creation of novel compounds with diverse applications in pharmaceuticals, agrochemicals, and materials science. In chemical synthesis, Valnemulin serves as a crucial building block, facilitating the development of innovative and sophisticated molecular architectures.