AA05293
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $32.00 | $23.00 | - + | |
1g | 98% | in stock | $71.00 | $50.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA05293 |
Chemical Name: | 8-Nitro-7-quinolinecarboxaldehyde |
CAS Number: | 101327-87-1 |
Molecular Formula: | C10H6N2O3 |
Molecular Weight: | 202.1662 |
MDL Number: | MFCD08436438 |
SMILES: | O=Cc1ccc2c(c1[N+](=O)[O-])nccc2 |
Complexity: | 264 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.5 |
8-Nitro-7-quinolinecarboxaldehyde is a versatile compound widely utilized in chemical synthesis as a key intermediate in the production of various pharmaceuticals, organic compounds, and pesticides. This specific compound plays a crucial role in the synthesis of quinoline derivatives, which are known for their diverse biological activities and pharmacological properties.In organic synthesis, 8-Nitro-7-quinolinecarboxaldehyde serves as a valuable building block for the construction of complex molecular structures due to its unique chemical reactivity and functional groups. It can undergo various chemical transformations such as reduction, oxidation, and condensation reactions to yield a wide range of derivatives with tailored properties.Furthermore, the presence of the nitro group in 8-Nitro-7-quinolinecarboxaldehyde offers opportunities for further derivatization through chemical modifications, making it a valuable precursor in the development of novel compounds for pharmaceutical and agrochemical applications. Its strategic placement within the quinoline ring system allows for the synthesis of compounds with enhanced bioactivity and target-specific functions.Overall, the application of 8-Nitro-7-quinolinecarboxaldehyde in chemical synthesis enables the efficient and precise construction of molecular frameworks with diverse functionalities, making it an essential intermediate in the synthesis of biologically active compounds and functional materials.