logo
Home  > Acarbose D-Fructose Impurity

AE15805

1013621-79-8 | Acarbose D-Fructose Impurity

Packsize Purity Availability Price Discounted Price    Quantity
25mg 2 weeks $3,640.00 $2,548.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE15805
Chemical Name: Acarbose D-Fructose Impurity
CAS Number: 1013621-79-8
Molecular Formula: C25H43NO18
Molecular Weight: 645.6048
SMILES: OC[C@H]([C@H]([C@H](C(=O)CO)O)O[C@H]1OC(CO)[C@H](C(C1O)O)O[C@H]1O[C@H](C)[C@H](C(C1O)O)N[C@H]1C=C(CO)C(C(C1O)O)O)O

 

Upstream Synthesis Route
  • The Acarbose D-Fructose Impurity plays a crucial role in chemical synthesis as it serves as a key starting material in the production of pharmaceutical compounds. This impurity is utilized for its ability to undergo selective chemical transformations, allowing for the introduction of specific functional groups or structural modifications in target molecules. By incorporating the Acarbose D-Fructose Impurity into synthetic pathways, chemists can tailor the properties and activities of resulting compounds, contributing to the development of novel drugs with improved efficacy and reduced side effects. Additionally, the functional versatility of this impurity makes it a valuable building block in the synthesis of complex organic molecules, paving the way for advancements in medicinal chemistry and drug discovery.
FEATURED PRODUCTS