logo
Home  > 4,6,10-Hexadecatrien-1-ol, 1-acetate, (4E,6E,10Z)-

AA05387

101372-99-0 | 4,6,10-Hexadecatrien-1-ol, 1-acetate, (4E,6E,10Z)-

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA05387
Chemical Name: 4,6,10-Hexadecatrien-1-ol, 1-acetate, (4E,6E,10Z)-
CAS Number: 101372-99-0
Molecular Formula: C18H30O2
Molecular Weight: 278.4296
SMILES: CCCCCC=CCC/C=C/C=C/CCCOC(=O)C

 

Upstream Synthesis Route
  • 4,6,10-Hexadecatrien-1-ol, acetate, (E,E,Z)-, also known as HDTA, is a versatile compound widely used in chemical synthesis. Its unique structure allows for its application in various reactions and processes.One of the key uses of HDTA in chemical synthesis is as a precursor in the preparation of fragrances and flavors. The presence of multiple double bonds in the molecule makes it a valuable starting material for the synthesis of complex aromatic compounds. Chemists often utilize HDTA as a building block to introduce specific functional groups or stereochemistry into the final product.Additionally, HDTA can serve as a valuable intermediate in the synthesis of bioactive compounds and pharmaceuticals. Its structural features make it a versatile starting material for the preparation of molecules with potential medicinal properties. By incorporating HDTA into synthetic routes, chemists can tailor the properties of the final compound for specific biological activities.Furthermore, HDTA plays a crucial role in the development of new materials and polymers. Its reactivity and flexibility in chemical transformations make it an ideal candidate for modifying the properties of polymers or designing novel materials with desired characteristics. By incorporating HDTA into polymerization reactions, researchers can create materials with improved mechanical, thermal, or optical properties.Overall, 4,6,10-Hexadecatrien-1-ol, acetate, (E,E,Z)-, is a valuable compound in chemical synthesis with diverse applications in the preparation of fragrances, pharmaceuticals, materials, and more. Its versatility and reactivity make it a valuable tool for chemists seeking to design and create complex molecules for various purposes.
FEATURED PRODUCTS