AE29993
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE29993 |
Chemical Name: | alpha-D-glucose 1,6-bis(dihydrogen phosphate) |
CAS Number: | 10139-18-1 |
Molecular Formula: | C6H14O12P2 |
Molecular Weight: | 340.1157 |
MDL Number: | MFCD00006587 |
SMILES: | O[C@@H]1[C@@H](COP(=O)(O)O)O[C@@H]([C@@H]([C@H]1O)O)OP(=O)(O)O |
Glucose 1,6-bisphosphate plays a pivotal role in chemical synthesis as a key intermediate in the glycolysis metabolic pathway. In organic chemistry, it is often utilized as a phosphorylated sugar derivative with potential applications in the production of various bioactive compounds. Due to its unique structure and reactivity, Glucose 1,6-bisphosphate serves as a versatile building block for the synthesis of complex molecules, including pharmaceuticals, agrochemicals, and other fine chemicals. By harnessing its chemical properties, researchers and chemists can efficiently introduce phosphate moieties into target molecules, facilitating the development of new drugs or functional materials. Its strategic placement at a crucial metabolic junction provides valuable opportunities for synthetic transformations, making it a valuable tool in the realm of chemical synthesis.