AX12356
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 98% | in stock | $133.00 | $93.00 | - + | |
100mg | 98% | in stock | $178.00 | $124.00 | - + | |
250mg | 98% | in stock | $268.00 | $187.00 | - + | |
1g | 98% | in stock | $835.00 | $584.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX12356 |
Chemical Name: | 2-(Trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine hydrochloride |
CAS Number: | 1013905-12-8 |
Molecular Formula: | C6H8ClF3N4 |
Molecular Weight: | 228.6027 |
MDL Number: | MFCD11044797 |
SMILES: | FC(c1nn2c(n1)CNCC2)(F)F.Cl |
Complexity: | 195 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
The compound [1,2,4]Triazolo[1,5-a]pyrazine, 5,6,7,8-tetrahydro-2-(trifluoromethyl)-, hydrochloride (1:1) is commonly used in chemical synthesis for its unique properties and reactivity. This compound serves as a versatile building block in the creation of various organic molecules. Its trifluoromethyl group enhances the compound's stability and ability to participate in diverse chemical reactions, making it a valuable tool in the synthesis of pharmaceuticals, agrochemicals, and advanced materials. Additionally, the [1,2,4]Triazolo[1,5-a]pyrazine core structure provides a platform for the development of novel compounds with potential applications in medicinal chemistry and materials science.