AA05572
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 50% | in stock | $14.00 | $10.00 | - + | |
5g | 50% | in stock | $18.00 | $12.00 | - + | |
10g | 50% | in stock | $22.00 | $15.00 | - + | |
25g | 50% | in stock | $26.00 | $18.00 | - + | |
100g | 50% | in stock | $59.00 | $41.00 | - + | |
500g | 50% | in stock | $242.00 | $169.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA05572 |
Chemical Name: | Policresulen |
CAS Number: | 101418-00-2 |
Molecular Formula: | C8H10O5S |
Molecular Weight: | 218.227 |
MDL Number: | MFCD00869035 |
SMILES: | Cc1ccc(c(c1)O)S(=O)(=O)O.C=O |
Complexity: | 1140 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 38 |
Hydrogen Bond Acceptor Count: | 12 |
Hydrogen Bond Donor Count: | 6 |
Rotatable Bond Count: | 7 |
XLogP3: | 3.7 |
Benzenesulfonic acid, 2-hydroxy-4-methyl-, polymer with formaldehyde is a versatile compound used in a variety of chemical synthesis processes. This polymer is commonly employed as a catalyst or as a reactive intermediate in organic reactions. Its unique structure allows it to facilitate the formation of complex molecular structures with high efficiency. In addition, this polymer can serve as a cross-linking agent in polymerization reactions, enhancing the mechanical and thermal properties of the resulting materials. Furthermore, it finds applications in the synthesis of specialty chemicals, pharmaceuticals, and advanced materials due to its reactivity and stability under diverse reaction conditions.
Theriogenology 20120601
Theriogenology 20100701
DTW. Deutsche tierarztliche Wochenschrift 20050101
Annals of the New York Academy of Sciences 20041001