AA06218
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $68.00 | $48.00 | - + | |
1g | 95% | in stock | $73.00 | $51.00 | - + | |
5g | 95% | in stock | $225.00 | $158.00 | - + | |
25g | 95% | in stock | $914.00 | $640.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA06218 |
Chemical Name: | 3,4,5-Trimethoxyphenyl isocyanate |
CAS Number: | 1016-19-9 |
Molecular Formula: | C10H11NO4 |
Molecular Weight: | 209.1986 |
MDL Number: | MFCD00013861 |
SMILES: | O=C=Nc1cc(OC)c(c(c1)OC)OC |
Complexity: | 226 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.6 |
3,4,5-Trimethoxyphenylisocyanate, also known as TMPIC, is a versatile compound widely used in chemical synthesis. As a potent isocyanate compound, TMPIC serves as a key building block in the production of various complex molecules and pharmaceutical intermediates. Its unique reactivity makes it particularly valuable in organic synthesis processes, where it can participate in a range of critical reactions.One of the primary applications of 3,4,5-Trimethoxyphenylisocyanate is in the synthesis of heterocyclic compounds and pharmaceutical drugs. By reacting TMPIC with appropriate nucleophiles or other reagents, chemists can introduce the isocyanate group into target molecules, enabling the creation of structurally diverse compounds with valuable properties. The isocyanate functionality of TMPIC facilitates the formation of peptide bonds, urethanes, and other important chemical linkages, making it an essential component in the preparation of drug candidates and bioactive molecules.Additionally, 3,4,5-Trimethoxyphenylisocyanate finds application in the preparation of advanced materials and polymers. Its ability to undergo polymerization reactions and form crosslinked networks makes it a useful ingredient in the development of specialty coatings, adhesives, and materials with tailored properties. TMPIC's unique molecular structure and reactivity offer chemists a powerful tool for designing and synthesizing innovative materials with controlled characteristics and enhanced performance.In summary, 3,4,5-Trimethoxyphenylisocyanate plays a crucial role in chemical synthesis, enabling the efficient construction of complex molecules, pharmaceutical intermediates, and advanced materials. Its versatile reactivity and compatibility with a wide range of reactions make it an indispensable compound in the toolkit of synthetic chemists seeking to create novel compounds with valuable applications in various fields.