AA06214
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 96% | in stock | $28.00 | $20.00 | - + | |
100mg | 96% | in stock | $33.00 | $23.00 | - + | |
250mg | 96% | in stock | $40.00 | $28.00 | - + | |
1g | 96% | in stock | $78.00 | $54.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA06214 |
Chemical Name: | N-Acetyltryptamine |
CAS Number: | 1016-47-3 |
Molecular Formula: | C12H14N2O |
Molecular Weight: | 202.25235999999998 |
MDL Number: | MFCD00209910 |
SMILES: | CC(=O)NCCc1c[nH]c2c1cccc2 |
N-(2-(1H-Indol-3-yl)ethyl)acetamide, commonly known as $name$ in chemical synthesis, serves as a versatile building block due to its unique molecular structure and reactivity. This compound plays a crucial role in the production of various pharmaceuticals, agrochemicals, and fine chemicals through its ability to undergo numerous transformations in organic synthesis.One notable application of $name$ is in the synthesis of novel indole-based drug candidates. By utilizing $name$ as a key intermediate, chemists can introduce functional groups or modify the indole ring to create structurally diverse compounds with potential therapeutic properties. The presence of the acetamide group in $name$ provides a handle for further derivatization, allowing for the fine-tuning of desired pharmacological properties.Moreover, $name$ can also be employed in the synthesis of natural products and bioactive molecules. Its ability to participate in various organic reactions, such as alkylation, acylation, and cyclization, enables the efficient construction of complex molecular architectures. As a result, $name$ serves as a valuable tool for chemists aiming to access challenging structural motifs in the preparation of bioactive compounds.Overall, the versatility and synthetic utility of N-(2-(1H-Indol-3-yl)ethyl)acetamide make it a valuable component in the toolbox of organic chemists, facilitating the development of innovative chemical entities with potential applications in medicinal chemistry and beyond.