AA06241
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 98% | in stock | $250.00 | $175.00 | - + | |
10mg | 98% | in stock | $384.00 | $269.00 | - + | |
25mg | 98% | in stock | $750.00 | $525.00 | - + | |
50mg | 98% | in stock | $1,237.00 | $866.00 | - + | |
100mg | 98% | in stock | $2,100.00 | $1,470.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA06241 |
Chemical Name: | Benzoic acid, 4-[4-[(2-bromoacetyl)amino]butyl]- |
CAS Number: | 10161-87-2 |
Molecular Formula: | C13H16BrNO3 |
Molecular Weight: | 314.17504 |
MDL Number: | MFCD32194457 |
SMILES: | BrCC(=O)NCCCCc1ccc(cc1)C(=O)O |
Benzoic acid, 4-[4-[(2-bromoacetyl)amino]butyl]- is a versatile compound used in chemical synthesis for its unique properties and applications. This compound is commonly employed as a building block in organic reactions and synthesis processes due to its functionality and reactivity.In chemical synthesis, Benzoic acid, 4-[4-[(2-bromoacetyl)amino]butyl]- can serve as a key intermediate for the preparation of various complex molecules, such as pharmaceuticals, agrochemicals, and functional materials. Its ability to undergo selective reactions and form stable intermediates makes it a valuable tool for organic chemists.Furthermore, the presence of the bromoacetyl group in this compound allows for further derivatization and modification, expanding its utility in the synthesis of diverse chemical compounds. Whether utilized as a reagent, catalyst, or precursor, Benzoic acid, 4-[4-[(2-bromoacetyl)amino]butyl]- plays a crucial role in advancing synthetic strategies and achieving the desired molecular structures in chemical research and development.Overall, the application of Benzoic acid, 4-[4-[(2-bromoacetyl)amino]butyl]- in chemical synthesis offers a wide range of possibilities for designing and constructing novel molecules with tailored properties and functionalities.