AA06684
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $13.00 | $9.00 | - + | |
25g | 98% | in stock | $20.00 | $14.00 | - + | |
100g | 98% | in stock | $57.00 | $40.00 | - + | |
500g | 98% | in stock | $278.00 | $195.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA06684 |
Chemical Name: | N-Acetyl-D-phenylalanine |
CAS Number: | 10172-89-1 |
Molecular Formula: | C11H13NO3 |
Molecular Weight: | 207.2258 |
MDL Number: | MFCD00002664 |
SMILES: | OC(=O)[C@@H](Cc1ccccc1)NC(=O)C |
Complexity: | 234 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 0.6 |
The Journal of organic chemistry 20070427