logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Pyrazoles  > 4-(1H-Pyrazol-4-yl)benzoic acid

AE09413

1017794-47-6 | 4-(1H-Pyrazol-4-yl)benzoic acid

Packsize Purity Availability Price Discounted Price    Quantity
250mg 96% in stock $41.00 $29.00 -   +
500mg 96% in stock $82.00 $58.00 -   +
1g 96% in stock $161.00 $113.00 -   +
5g 96% in stock $760.00 $532.00 -   +
10g 96% in stock $1,132.00 $793.00 -   +
25g 96% in stock $2,004.00 $1,403.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE09413
Chemical Name: 4-(1H-Pyrazol-4-yl)benzoic acid
CAS Number: 1017794-47-6
Molecular Formula: C10H8N2O2
Molecular Weight: 188.1827
MDL Number: MFCD06803014
SMILES: OC(=O)c1ccc(cc1)c1c[nH]nc1

 

Computed Properties
Complexity: 212  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 14  
Hydrogen Bond Acceptor Count: 3  
Hydrogen Bond Donor Count: 2  
Rotatable Bond Count: 2  
XLogP3: 1.4  

 

 

Upstream Synthesis Route
  • 4-(1H-Pyrazol-4-yl)benzoic acid, also known as $name$, is a versatile compound widely used in chemical synthesis. Its unique chemical structure makes it an essential building block in various organic reactions and transformations.One significant application of 4-(1H-Pyrazol-4-yl)benzoic acid is as a key intermediate in the synthesis of pharmaceuticals. This compound serves as a crucial starting material in the production of bioactive molecules, such as potential drugs and therapeutic agents. Its functional groups and reactivity enable it to participate in a range of chemical reactions, allowing for the efficient creation of complex molecules with desired biological properties.Furthermore, 4-(1H-Pyrazol-4-yl)benzoic acid is utilized in the preparation of advanced materials and specialty chemicals. Its structural versatility and ability to undergo various synthetic modifications make it an indispensable component in the development of new materials with tailored properties. From dyes and pigments to polymers and organic electronics, this compound plays a pivotal role in advancing the field of materials science.In the realm of chemical research, 4-(1H-Pyrazol-4-yl)benzoic acid serves as a valuable tool for exploring new reaction pathways and mechanisms. By incorporating this compound into synthetic strategies, chemists can probe the reactivity and selectivity of different chemical reactions, facilitating the discovery of novel synthetic methodologies and the elucidation of complex chemical processes.Overall, 4-(1H-Pyrazol-4-yl)benzoic acid stands as a fundamental component in the realm of chemical synthesis, offering a myriad of opportunities for the creation of innovative molecules, materials, and scientific breakthroughs.
FEATURED PRODUCTS